C6H5F9O — CID 2782627
4,4,4-trifluoro-3,3-bis(trifluoromethyl)butan-1-ol (PubChem CID 2782627) has the molecular formula C6H5F9O and a molecular weight of 264.09 g/mol. Its IUPAC name is 4,4,4-trifluoro-3,3-bis(trifluoromethyl)butan-1-ol.
| Compound Name | 4,4,4-trifluoro-3,3-bis(trifluoromethyl)butan-1-ol |
|---|---|
| PubChem CID | 2782627 |
| Molecular Formula | C6H5F9O |
| Molecular Weight | 264.09 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 4,4,4-trifluoro-3,3-bis(trifluoromethyl)butan-1-ol |
| SMILES | OCCC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H5F9O/c7-4(8,9)3(1-2-16,5(10,11)12)6(13,14)15/h16H,1-2H2 |
| InChIKey | BUPOXNIZANUQTQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.09 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |