C9H9F5O3Si — CID 2782640
trimethoxy-(2,3,4,5,6-pentafluorophenyl)silane (PubChem CID 2782640) has the molecular formula C9H9F5O3Si and a molecular weight of 288.24 g/mol. Its IUPAC name is trimethoxy-(2,3,4,5,6-pentafluorophenyl)silane.
| Compound Name | trimethoxy-(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| PubChem CID | 2782640 |
| Molecular Formula | C9H9F5O3Si |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | trimethoxy-(2,3,4,5,6-pentafluorophenyl)silane |
| SMILES | CO[Si](OC)(OC)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H9F5O3Si/c1-15-18(16-2,17-3)9-7(13)5(11)4(10)6(12)8(9)14/h1-3H3 |
| InChIKey | XFFHTZIRHGKTBQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|