About 3,3-difluoropyrrolidine
3,3-difluoropyrrolidine (PubChem CID 2782827) has the molecular formula C4H7F2N
and a molecular weight of 107.10 g/mol. Its IUPAC name is 3,3-difluoropyrrolidine.
Molecular Properties
| Compound Name | 3,3-difluoropyrrolidine |
| PubChem CID | 2782827 |
| Molecular Formula | C4H7F2N |
| Molecular Weight | 107.10 g/mol |
| Exact Mass | 107.05 |
| IUPAC Name | 3,3-difluoropyrrolidine |
| SMILES | FC1(F)CCNC1 |
| InChI | InChI=1S/C4H7F2N/c5-4(6)1-2-7-3-4/h7H,1-3H2 |
| InChIKey | KVTUSMPNLUCCQO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.10 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-difluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoropyrrolidine?
The IUPAC name of 3,3-difluoropyrrolidine (CID 2782827) is 3,3-difluoropyrrolidine.
What is the SMILES notation for 3,3-difluoropyrrolidine?
The canonical SMILES for 3,3-difluoropyrrolidine is FC1(F)CCNC1.
What is the InChIKey of 3,3-difluoropyrrolidine?
The InChIKey is KVTUSMPNLUCCQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7F2N/c5-4(6)1-2-7-3-4/h7H,1-3H2.
What are the key properties of 3,3-difluoropyrrolidine?
3,3-difluoropyrrolidine has a molecular weight of 107.10 g/mol, XLogP of 0.62, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoropyrrolidine is sourced from PubChem (CID 2782827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).