C13H6ClF5O3S — CID 2782921
(2,3,4,5,6-pentafluorophenyl) (3-chlorophenyl)methanesulfonate (PubChem CID 2782921) has the molecular formula C13H6ClF5O3S and a molecular weight of 372.70 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (3-chlorophenyl)methanesulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (3-chlorophenyl)methanesulfonate |
|---|---|
| PubChem CID | 2782921 |
| Molecular Formula | C13H6ClF5O3S |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (3-chlorophenyl)methanesulfonate |
| SMILES | O=S(=O)(Cc1cccc(Cl)c1)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H6ClF5O3S/c14-7-3-1-2-6(4-7)5-23(20,21)22-13-11(18)9(16)8(15)10(17)12(13)19/h1-4H,5H2 |
| InChIKey | HBIDYDWSCOTXFM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|