About 5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-amine
5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-amine (PubChem CID 2783071) has the molecular formula C10H5F6N3
and a molecular weight of 281.16 g/mol. Its IUPAC name is 5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-amine.
Molecular Properties
| Compound Name | 5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-amine |
| PubChem CID | 2783071 |
| Molecular Formula | C10H5F6N3 |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-amine |
| SMILES | Nc1ccc2c(C(F)(F)F)cc(C(F)(F)F)nc2n1 |
| InChI | InChI=1S/C10H5F6N3/c11-9(12,13)5-3-6(10(14,15)16)18-8-4(5)1-2-7(17)19-8/h1-3H,(H2,17,18,19) |
| InChIKey | CLSSRJKZGCCBKL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-amine?
The IUPAC name of 5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-amine (CID 2783071) is 5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-amine.
What is the SMILES notation for 5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-amine?
The canonical SMILES for 5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-amine is Nc1ccc2c(C(F)(F)F)cc(C(F)(F)F)nc2n1.
What is the InChIKey of 5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-amine?
The InChIKey is CLSSRJKZGCCBKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F6N3/c11-9(12,13)5-3-6(10(14,15)16)18-8-4(5)1-2-7(17)19-8/h1-3H,(H2,17,18,19).
What are the key properties of 5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-amine?
5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-amine has a molecular weight of 281.16 g/mol, XLogP of 3.25, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-bis(trifluoromethyl)-1,8-naphthyridin-2-amine is sourced from PubChem (CID 2783071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).