About diethylazanium;trifluoromethanesulfonate
diethylazanium;trifluoromethanesulfonate (PubChem CID 2783161) has the molecular formula C5H12F3NO3S
and a molecular weight of 223.22 g/mol. Its IUPAC name is diethylazanium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | diethylazanium;trifluoromethanesulfonate |
| PubChem CID | 2783161 |
| Molecular Formula | C5H12F3NO3S |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | diethylazanium;trifluoromethanesulfonate |
| SMILES | CC[NH2+]CC.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C4H11N.CHF3O3S/c1-3-5-4-2;2-1(3,4)8(5,6)7/h5H,3-4H2,1-2H3;(H,5,6,7) |
| InChIKey | BGIBIBGZOYSFSC-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze diethylazanium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylazanium;trifluoromethanesulfonate?
The IUPAC name of diethylazanium;trifluoromethanesulfonate (CID 2783161) is diethylazanium;trifluoromethanesulfonate.
What is the SMILES notation for diethylazanium;trifluoromethanesulfonate?
The canonical SMILES for diethylazanium;trifluoromethanesulfonate is CC[NH2+]CC.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of diethylazanium;trifluoromethanesulfonate?
The InChIKey is BGIBIBGZOYSFSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N.CHF3O3S/c1-3-5-4-2;2-1(3,4)8(5,6)7/h5H,3-4H2,1-2H3;(H,5,6,7).
What are the key properties of diethylazanium;trifluoromethanesulfonate?
diethylazanium;trifluoromethanesulfonate has a molecular weight of 223.22 g/mol, XLogP of -0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethylazanium;trifluoromethanesulfonate is sourced from PubChem (CID 2783161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).