About 2,3,6-trifluoropyridine
2,3,6-trifluoropyridine (PubChem CID 2783288) has the molecular formula C5H2F3N
and a molecular weight of 133.07 g/mol. Its IUPAC name is 2,3,6-trifluoropyridine.
Molecular Properties
| Compound Name | 2,3,6-trifluoropyridine |
| PubChem CID | 2783288 |
| Molecular Formula | C5H2F3N |
| Molecular Weight | 133.07 g/mol |
| Exact Mass | 133.01 |
| IUPAC Name | 2,3,6-trifluoropyridine |
| SMILES | Fc1ccc(F)c(F)n1 |
| InChI | InChI=1S/C5H2F3N/c6-3-1-2-4(7)9-5(3)8/h1-2H |
| InChIKey | HRLIANGJWPJFKW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.07 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,3,6-trifluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,6-trifluoropyridine?
The IUPAC name of 2,3,6-trifluoropyridine (CID 2783288) is 2,3,6-trifluoropyridine.
What is the SMILES notation for 2,3,6-trifluoropyridine?
The canonical SMILES for 2,3,6-trifluoropyridine is Fc1ccc(F)c(F)n1.
What is the InChIKey of 2,3,6-trifluoropyridine?
The InChIKey is HRLIANGJWPJFKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2F3N/c6-3-1-2-4(7)9-5(3)8/h1-2H.
What are the key properties of 2,3,6-trifluoropyridine?
2,3,6-trifluoropyridine has a molecular weight of 133.07 g/mol, XLogP of 1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,6-trifluoropyridine is sourced from PubChem (CID 2783288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).