C19H3F15OSi — CID 2783338
methoxy-tris(2,3,4,5,6-pentafluorophenyl)silane (PubChem CID 2783338) has the molecular formula C19H3F15OSi and a molecular weight of 560.29 g/mol. Its IUPAC name is methoxy-tris(2,3,4,5,6-pentafluorophenyl)silane.
| Compound Name | methoxy-tris(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| PubChem CID | 2783338 |
| Molecular Formula | C19H3F15OSi |
| Molecular Weight | 560.29 g/mol |
| Exact Mass | 559.97 |
| IUPAC Name | methoxy-tris(2,3,4,5,6-pentafluorophenyl)silane |
| SMILES | CO[Si](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H3F15OSi/c1-35-36(17-11(29)5(23)2(20)6(24)12(17)30,18-13(31)7(25)3(21)8(26)14(18)32)19-15(33)9(27)4(22)10(28)16(19)34/h1H3 |
| InChIKey | ZORPDMBUBHIUBO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.29 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|