C6H2F12O — CID 2783350
1,1,2,2,3,3,4,4-octafluoro-1-(1,1,2,2-tetrafluoroethoxy)butane (PubChem CID 2783350) has the molecular formula C6H2F12O and a molecular weight of 318.06 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-1-(1,1,2,2-tetrafluoroethoxy)butane.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-1-(1,1,2,2-tetrafluoroethoxy)butane |
|---|---|
| PubChem CID | 2783350 |
| Molecular Formula | C6H2F12O |
| Molecular Weight | 318.06 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-1-(1,1,2,2-tetrafluoroethoxy)butane |
| SMILES | FC(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C6H2F12O/c7-1(8)3(11,12)5(15,16)6(17,18)19-4(13,14)2(9)10/h1-2H |
| InChIKey | AWIZRYZDKMGMNN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.06 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|