C38H26N10O4 — CID 2783537
(4-nitrophenyl)-[4-[4-[4-[(4-nitrophenyl)diazenyl]phenyl]-3,6-diphenyl-1,2,4,5-tetrazin-1-yl]phenyl]diazene (PubChem CID 2783537) has the molecular formula C38H26N10O4 and a molecular weight of 686.69 g/mol. Its IUPAC name is (4-nitrophenyl)-[4-[4-[4-[(4-nitrophenyl)diazenyl]phenyl]-3,6-diphenyl-1,2,4,5-tetrazin-1-yl]phenyl]diazene.
| Compound Name | (4-nitrophenyl)-[4-[4-[4-[(4-nitrophenyl)diazenyl]phenyl]-3,6-diphenyl-1,2,4,5-tetrazin-1-yl]phenyl]diazene |
|---|---|
| PubChem CID | 2783537 |
| Molecular Formula | C38H26N10O4 |
| Molecular Weight | 686.69 g/mol |
| Exact Mass | 686.21 |
| IUPAC Name | (4-nitrophenyl)-[4-[4-[4-[(4-nitrophenyl)diazenyl]phenyl]-3,6-diphenyl-1,2,4,5-tetrazin-1-yl]phenyl]diazene |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2ccc(N3N=C(c4ccccc4)N(c4ccc(/N=N/c5ccc([N+](=O)[O-])cc5)cc4)N=C3c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C38H26N10O4/c49-47(50)35-23-15-31(16-24-35)41-39-29-11-19-33(20-12-29)45-37(27-7-3-1-4-8-27)43-46(38(44-45)28-9-5-2-6-10-28)34-21-13-30(14-22-34)40-42-32-17-25-36(26-18-32)48(51)52/h1-26H/b41-39+,42-40+ |
| InChIKey | ASPYOIRAFRTNCF-LMXNTIJMSA-N |
| XLogP | 10.38 |
| TPSA | 166.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.69 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|