C17H14N4O2 — CID 2783708
3-nitro-2-N,6-N-diphenylpyridine-2,6-diamine (PubChem CID 2783708) has the molecular formula C17H14N4O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 3-nitro-2-N,6-N-diphenylpyridine-2,6-diamine.
| Compound Name | 3-nitro-2-N,6-N-diphenylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 2783708 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 3-nitro-2-N,6-N-diphenylpyridine-2,6-diamine |
| SMILES | O=[N+]([O-])c1ccc(Nc2ccccc2)nc1Nc1ccccc1 |
| InChI | InChI=1S/C17H14N4O2/c22-21(23)15-11-12-16(18-13-7-3-1-4-8-13)20-17(15)19-14-9-5-2-6-10-14/h1-12H,(H2,18,19,20) |
| InChIKey | ZTWGSWOQHQHKQJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|