About 1-(3-bromopropyl)-3,6-dimethylpyrimidine-2,4-dione
1-(3-bromopropyl)-3,6-dimethylpyrimidine-2,4-dione (PubChem CID 2783721) has the molecular formula C9H13BrN2O2
and a molecular weight of 261.12 g/mol. Its IUPAC name is 1-(3-bromopropyl)-3,6-dimethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-(3-bromopropyl)-3,6-dimethylpyrimidine-2,4-dione |
| PubChem CID | 2783721 |
| Molecular Formula | C9H13BrN2O2 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 1-(3-bromopropyl)-3,6-dimethylpyrimidine-2,4-dione |
| SMILES | Cc1cc(=O)n(C)c(=O)n1CCCBr |
| InChI | InChI=1S/C9H13BrN2O2/c1-7-6-8(13)11(2)9(14)12(7)5-3-4-10/h6H,3-5H2,1-2H3 |
| InChIKey | ZJJBHWMEVVAJSC-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-bromopropyl)-3,6-dimethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromopropyl)-3,6-dimethylpyrimidine-2,4-dione?
The IUPAC name of 1-(3-bromopropyl)-3,6-dimethylpyrimidine-2,4-dione (CID 2783721) is 1-(3-bromopropyl)-3,6-dimethylpyrimidine-2,4-dione.
What is the SMILES notation for 1-(3-bromopropyl)-3,6-dimethylpyrimidine-2,4-dione?
The canonical SMILES for 1-(3-bromopropyl)-3,6-dimethylpyrimidine-2,4-dione is Cc1cc(=O)n(C)c(=O)n1CCCBr.
What is the InChIKey of 1-(3-bromopropyl)-3,6-dimethylpyrimidine-2,4-dione?
The InChIKey is ZJJBHWMEVVAJSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BrN2O2/c1-7-6-8(13)11(2)9(14)12(7)5-3-4-10/h6H,3-5H2,1-2H3.
What are the key properties of 1-(3-bromopropyl)-3,6-dimethylpyrimidine-2,4-dione?
1-(3-bromopropyl)-3,6-dimethylpyrimidine-2,4-dione has a molecular weight of 261.12 g/mol, XLogP of 0.64, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromopropyl)-3,6-dimethylpyrimidine-2,4-dione is sourced from PubChem (CID 2783721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).