About 3-bromo-5-methoxy-2,6-dinitropyridine
3-bromo-5-methoxy-2,6-dinitropyridine (PubChem CID 2783820) has the molecular formula C6H4BrN3O5
and a molecular weight of 278.02 g/mol. Its IUPAC name is 3-bromo-5-methoxy-2,6-dinitropyridine.
Molecular Properties
| Compound Name | 3-bromo-5-methoxy-2,6-dinitropyridine |
| PubChem CID | 2783820 |
| Molecular Formula | C6H4BrN3O5 |
| Molecular Weight | 278.02 g/mol |
| Exact Mass | 276.93 |
| IUPAC Name | 3-bromo-5-methoxy-2,6-dinitropyridine |
| SMILES | COc1cc(Br)c([N+](=O)[O-])nc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H4BrN3O5/c1-15-4-2-3(7)5(9(11)12)8-6(4)10(13)14/h2H,1H3 |
| InChIKey | SRZZCSXOCJYUDB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 108.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.02 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-5-methoxy-2,6-dinitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-methoxy-2,6-dinitropyridine?
The IUPAC name of 3-bromo-5-methoxy-2,6-dinitropyridine (CID 2783820) is 3-bromo-5-methoxy-2,6-dinitropyridine.
What is the SMILES notation for 3-bromo-5-methoxy-2,6-dinitropyridine?
The canonical SMILES for 3-bromo-5-methoxy-2,6-dinitropyridine is COc1cc(Br)c([N+](=O)[O-])nc1[N+](=O)[O-].
What is the InChIKey of 3-bromo-5-methoxy-2,6-dinitropyridine?
The InChIKey is SRZZCSXOCJYUDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrN3O5/c1-15-4-2-3(7)5(9(11)12)8-6(4)10(13)14/h2H,1H3.
What are the key properties of 3-bromo-5-methoxy-2,6-dinitropyridine?
3-bromo-5-methoxy-2,6-dinitropyridine has a molecular weight of 278.02 g/mol, XLogP of 1.67, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-methoxy-2,6-dinitropyridine is sourced from PubChem (CID 2783820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).