C5H8N4O2 — CID 27840
4,6-dimethoxy-1,3,5-triazin-2-amine (PubChem CID 27840) has the molecular formula C5H8N4O2 and a molecular weight of 156.15 g/mol. Its IUPAC name is 4,6-dimethoxy-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dimethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 27840 |
| Molecular Formula | C5H8N4O2 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 4,6-dimethoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(N)nc(OC)n1 |
| InChI | InChI=1S/C5H8N4O2/c1-10-4-7-3(6)8-5(9-4)11-2/h1-2H3,(H2,6,7,8,9) |
| InChIKey | KVHFZZUPCXCRIX-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |