About 6-hydroxy-1,3-dihydroindol-2-one
6-hydroxy-1,3-dihydroindol-2-one (PubChem CID 2784139) has the molecular formula C8H7NO2
and a molecular weight of 149.15 g/mol. Its IUPAC name is 6-hydroxy-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 6-hydroxy-1,3-dihydroindol-2-one |
| PubChem CID | 2784139 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 6-hydroxy-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2ccc(O)cc2N1 |
| InChI | InChI=1S/C8H7NO2/c10-6-2-1-5-3-8(11)9-7(5)4-6/h1-2,4,10H,3H2,(H,9,11) |
| InChIKey | ZOJZYAPVVOLQQB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-hydroxy-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-1,3-dihydroindol-2-one?
The IUPAC name of 6-hydroxy-1,3-dihydroindol-2-one (CID 2784139) is 6-hydroxy-1,3-dihydroindol-2-one.
What is the SMILES notation for 6-hydroxy-1,3-dihydroindol-2-one?
The canonical SMILES for 6-hydroxy-1,3-dihydroindol-2-one is O=C1Cc2ccc(O)cc2N1.
What is the InChIKey of 6-hydroxy-1,3-dihydroindol-2-one?
The InChIKey is ZOJZYAPVVOLQQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2/c10-6-2-1-5-3-8(11)9-7(5)4-6/h1-2,4,10H,3H2,(H,9,11).
What are the key properties of 6-hydroxy-1,3-dihydroindol-2-one?
6-hydroxy-1,3-dihydroindol-2-one has a molecular weight of 149.15 g/mol, XLogP of 0.89, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-1,3-dihydroindol-2-one is sourced from PubChem (CID 2784139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).