C14H9Cl2N3O2 — CID 2784455
7-amino-3,6-dichloro-3-phenyl-1H-1,8-naphthyridine-2,4-dione (PubChem CID 2784455) has the molecular formula C14H9Cl2N3O2 and a molecular weight of 322.15 g/mol. Its IUPAC name is 7-amino-3,6-dichloro-3-phenyl-1H-1,8-naphthyridine-2,4-dione.
| Compound Name | 7-amino-3,6-dichloro-3-phenyl-1H-1,8-naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 2784455 |
| Molecular Formula | C14H9Cl2N3O2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 7-amino-3,6-dichloro-3-phenyl-1H-1,8-naphthyridine-2,4-dione |
| SMILES | Nc1nc2c(cc1Cl)C(=O)C(Cl)(c1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C14H9Cl2N3O2/c15-9-6-8-10(20)14(16,7-4-2-1-3-5-7)13(21)19-12(8)18-11(9)17/h1-6H,(H3,17,18,19,21) |
| InChIKey | SLHMOAKBHHBMPK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|