About (3-benzyl-2,5-dioxo-6H-pyrano[3,2-c]quinolin-4-yl) acetate
(3-benzyl-2,5-dioxo-6H-pyrano[3,2-c]quinolin-4-yl) acetate (PubChem CID 2784457) has the molecular formula C21H15NO5
and a molecular weight of 361.35 g/mol. Its IUPAC name is (3-benzyl-2,5-dioxo-6H-pyrano[3,2-c]quinolin-4-yl) acetate.
Molecular Properties
| Compound Name | (3-benzyl-2,5-dioxo-6H-pyrano[3,2-c]quinolin-4-yl) acetate |
| PubChem CID | 2784457 |
| Molecular Formula | C21H15NO5 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | (3-benzyl-2,5-dioxo-6H-pyrano[3,2-c]quinolin-4-yl) acetate |
| SMILES | CC(=O)Oc1c(Cc2ccccc2)c(=O)oc2c1c(=O)[nH]c1ccccc12 |
| InChI | InChI=1S/C21H15NO5/c1-12(23)26-19-15(11-13-7-3-2-4-8-13)21(25)27-18-14-9-5-6-10-16(14)22-20(24)17(18)19/h2-10H,11H2,1H3,(H,22,24) |
| InChIKey | SCLQRMRWOIZQBN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (3-benzyl-2,5-dioxo-6H-pyrano[3,2-c]quinolin-4-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-benzyl-2,5-dioxo-6H-pyrano[3,2-c]quinolin-4-yl) acetate?
The IUPAC name of (3-benzyl-2,5-dioxo-6H-pyrano[3,2-c]quinolin-4-yl) acetate (CID 2784457) is (3-benzyl-2,5-dioxo-6H-pyrano[3,2-c]quinolin-4-yl) acetate.
What is the SMILES notation for (3-benzyl-2,5-dioxo-6H-pyrano[3,2-c]quinolin-4-yl) acetate?
The canonical SMILES for (3-benzyl-2,5-dioxo-6H-pyrano[3,2-c]quinolin-4-yl) acetate is CC(=O)Oc1c(Cc2ccccc2)c(=O)oc2c1c(=O)[nH]c1ccccc12.
What is the InChIKey of (3-benzyl-2,5-dioxo-6H-pyrano[3,2-c]quinolin-4-yl) acetate?
The InChIKey is SCLQRMRWOIZQBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15NO5/c1-12(23)26-19-15(11-13-7-3-2-4-8-13)21(25)27-18-14-9-5-6-10-16(14)22-20(24)17(18)19/h2-10H,11H2,1H3,(H,22,24).
What are the key properties of (3-benzyl-2,5-dioxo-6H-pyrano[3,2-c]quinolin-4-yl) acetate?
(3-benzyl-2,5-dioxo-6H-pyrano[3,2-c]quinolin-4-yl) acetate has a molecular weight of 361.35 g/mol, XLogP of 3.15, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-benzyl-2,5-dioxo-6H-pyrano[3,2-c]quinolin-4-yl) acetate is sourced from PubChem (CID 2784457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).