(1,2-dimethyl-6-oxo-4-pyridinyl) N,N-dimethylcarbamate

C10H14N2O3 — CID 2784463

IUPAC(1,2-dimethyl-6-oxo-4-pyridinyl) N,N-dimethylcarbamate
SMILESCc1cc(OC(=O)N(C)C)cc(=O)n1C
InChIInChI=1S/C10H14N2O3/c1-7-5-8(6-9(13)12(7)4)15-10(14)11(2)3/h5-6H,1-4H3
InChIKeyJPEXYTKLVGMQRK-UHFFFAOYSA-N
MW210.23 g/mol
LogP0.75
Rot. Bonds1

About (1,2-dimethyl-6-oxo-4-pyridinyl) N,N-dimethylcarbamate

(1,2-dimethyl-6-oxo-4-pyridinyl) N,N-dimethylcarbamate (PubChem CID 2784463) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is (1,2-dimethyl-6-oxo-4-pyridinyl) N,N-dimethylcarbamate.

Molecular Properties

Compound Name(1,2-dimethyl-6-oxo-4-pyridinyl) N,N-dimethylcarbamate
PubChem CID2784463
Molecular FormulaC10H14N2O3
Molecular Weight210.23 g/mol
Exact Mass210.10
IUPAC Name(1,2-dimethyl-6-oxo-4-pyridinyl) N,N-dimethylcarbamate
SMILESCc1cc(OC(=O)N(C)C)cc(=O)n1C
InChIInChI=1S/C10H14N2O3/c1-7-5-8(6-9(13)12(7)4)15-10(14)11(2)3/h5-6H,1-4H3
InChIKeyJPEXYTKLVGMQRK-UHFFFAOYSA-N
XLogP0.75
TPSA51.54 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.23
LogP ≤ 50.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (1,2-dimethyl-6-oxo-4-pyridinyl) N,N-dimethylcarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,2-dimethyl-6-oxo-4-pyridinyl) N,N-dimethylcarbamate?
The IUPAC name of (1,2-dimethyl-6-oxo-4-pyridinyl) N,N-dimethylcarbamate (CID 2784463) is (1,2-dimethyl-6-oxo-4-pyridinyl) N,N-dimethylcarbamate.
What is the SMILES notation for (1,2-dimethyl-6-oxo-4-pyridinyl) N,N-dimethylcarbamate?
The canonical SMILES for (1,2-dimethyl-6-oxo-4-pyridinyl) N,N-dimethylcarbamate is Cc1cc(OC(=O)N(C)C)cc(=O)n1C.
What is the InChIKey of (1,2-dimethyl-6-oxo-4-pyridinyl) N,N-dimethylcarbamate?
The InChIKey is JPEXYTKLVGMQRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3/c1-7-5-8(6-9(13)12(7)4)15-10(14)11(2)3/h5-6H,1-4H3.
What are the key properties of (1,2-dimethyl-6-oxo-4-pyridinyl) N,N-dimethylcarbamate?
(1,2-dimethyl-6-oxo-4-pyridinyl) N,N-dimethylcarbamate has a molecular weight of 210.23 g/mol, XLogP of 0.75, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,2-dimethyl-6-oxo-4-pyridinyl) N,N-dimethylcarbamate is sourced from PubChem (CID 2784463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).