C8H5Cl3F3N2OP — CID 2784514
2,2,2-trichloro-3-phenyl-5-(trifluoromethyl)-1,3,4,2lambda5-oxadiazaphosphole (PubChem CID 2784514) has the molecular formula C8H5Cl3F3N2OP and a molecular weight of 339.47 g/mol. Its IUPAC name is 2,2,2-trichloro-3-phenyl-5-(trifluoromethyl)-1,3,4,2lambda5-oxadiazaphosphole.
| Compound Name | 2,2,2-trichloro-3-phenyl-5-(trifluoromethyl)-1,3,4,2lambda5-oxadiazaphosphole |
|---|---|
| PubChem CID | 2784514 |
| Molecular Formula | C8H5Cl3F3N2OP |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 337.92 |
| IUPAC Name | 2,2,2-trichloro-3-phenyl-5-(trifluoromethyl)-1,3,4,2lambda5-oxadiazaphosphole |
| SMILES | FC(F)(F)C1=NN(c2ccccc2)P(Cl)(Cl)(Cl)O1 |
| InChI | InChI=1S/C8H5Cl3F3N2OP/c9-18(10,11)16(6-4-2-1-3-5-6)15-7(17-18)8(12,13)14/h1-5H |
| InChIKey | PVJNAVXFXFCWBM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|