About CID 2784556
CID 2784556 (PubChem CID 2784556) has the molecular formula C15H16F3N2P
and a molecular weight of 312.28 g/mol.
Molecular Properties
| Compound Name | CID 2784556 |
| PubChem CID | 2784556 |
| Molecular Formula | C15H16F3N2P |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | — |
| SMILES | CN1C(c2ccccc2)=[N+](C)[P-]1(F)(F)(F)c1ccccc1 |
| InChI | InChI=1S/C15H16F3N2P/c1-19-15(13-9-5-3-6-10-13)20(2)21(19,16,17,18)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| InChIKey | UXIHLLRHLKIGHP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 2784556 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 2784556?
The IUPAC name of CID 2784556 (CID 2784556) is not available.
What is the SMILES notation for CID 2784556?
The canonical SMILES for CID 2784556 is CN1C(c2ccccc2)=[N+](C)[P-]1(F)(F)(F)c1ccccc1.
What is the InChIKey of CID 2784556?
The InChIKey is UXIHLLRHLKIGHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F3N2P/c1-19-15(13-9-5-3-6-10-13)20(2)21(19,16,17,18)14-11-7-4-8-12-14/h3-12H,1-2H3.
What are the key properties of CID 2784556?
CID 2784556 has a molecular weight of 312.28 g/mol, XLogP of 3.92, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 2784556 is sourced from PubChem (CID 2784556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).