C32H39P — CID 2784570
2,2-diphenylethenylidene-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 2784570) has the molecular formula C32H39P and a molecular weight of 454.64 g/mol. Its IUPAC name is 2,2-diphenylethenylidene-(2,4,6-tritert-butylphenyl)phosphane.
| Compound Name | 2,2-diphenylethenylidene-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 2784570 |
| Molecular Formula | C32H39P |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | 2,2-diphenylethenylidene-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(P=C=C(c2ccccc2)c2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H39P/c1-30(2,3)25-20-27(31(4,5)6)29(28(21-25)32(7,8)9)33-22-26(23-16-12-10-13-17-23)24-18-14-11-15-19-24/h10-21H,1-9H3 |
| InChIKey | SLIBMNOHYCVBSC-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|