C33H52NOP — CID 2784577
(2,6-ditert-butyl-4-methylphenoxy)-(2,4,6-tritert-butylphenyl)iminophosphane (PubChem CID 2784577) has the molecular formula C33H52NOP and a molecular weight of 509.76 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methylphenoxy)-(2,4,6-tritert-butylphenyl)iminophosphane.
| Compound Name | (2,6-ditert-butyl-4-methylphenoxy)-(2,4,6-tritert-butylphenyl)iminophosphane |
|---|---|
| PubChem CID | 2784577 |
| Molecular Formula | C33H52NOP |
| Molecular Weight | 509.76 g/mol |
| Exact Mass | 509.38 |
| IUPAC Name | (2,6-ditert-butyl-4-methylphenoxy)-(2,4,6-tritert-butylphenyl)iminophosphane |
| SMILES | Cc1cc(C(C)(C)C)c(O/P=N/c2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H52NOP/c1-21-17-25(32(11,12)13)28(26(18-21)33(14,15)16)35-36-34-27-23(30(5,6)7)19-22(29(2,3)4)20-24(27)31(8,9)10/h17-20H,1-16H3 |
| InChIKey | IVTPVYXXAMTSAX-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.76 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|