C18H36N2P2 — CID 2784581
(2,2,6,6-tetramethylpiperidin-1-yl)-(2,2,6,6-tetramethylpiperidin-1-yl)phosphanylidenephosphane (PubChem CID 2784581) has the molecular formula C18H36N2P2 and a molecular weight of 342.45 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-1-yl)-(2,2,6,6-tetramethylpiperidin-1-yl)phosphanylidenephosphane.
| Compound Name | (2,2,6,6-tetramethylpiperidin-1-yl)-(2,2,6,6-tetramethylpiperidin-1-yl)phosphanylidenephosphane |
|---|---|
| PubChem CID | 2784581 |
| Molecular Formula | C18H36N2P2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-1-yl)-(2,2,6,6-tetramethylpiperidin-1-yl)phosphanylidenephosphane |
| SMILES | CC1(C)CCCC(C)(C)N1/P=P/N1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C18H36N2P2/c1-15(2)11-9-12-16(3,4)19(15)21-22-20-17(5,6)13-10-14-18(20,7)8/h9-14H2,1-8H3 |
| InChIKey | NUVIFEBHISNCRP-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|