C21H20O5 — CID 27846226
(7-methoxynaphthalen-2-yl) 2-(3,4-dimethoxyphenyl)acetate (PubChem CID 27846226) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is (7-methoxynaphthalen-2-yl) 2-(3,4-dimethoxyphenyl)acetate.
| Compound Name | (7-methoxynaphthalen-2-yl) 2-(3,4-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 27846226 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (7-methoxynaphthalen-2-yl) 2-(3,4-dimethoxyphenyl)acetate |
| SMILES | COc1ccc2ccc(OC(=O)Cc3ccc(OC)c(OC)c3)cc2c1 |
| InChI | InChI=1S/C21H20O5/c1-23-17-7-5-15-6-8-18(13-16(15)12-17)26-21(22)11-14-4-9-19(24-2)20(10-14)25-3/h4-10,12-13H,11H2,1-3H3 |
| InChIKey | YFBFHKMPGZJDBV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|