C12H9NO3 — CID 2784639
1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,3,4-trione (PubChem CID 2784639) has the molecular formula C12H9NO3 and a molecular weight of 215.21 g/mol. Its IUPAC name is 1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,3,4-trione.
| Compound Name | 1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,3,4-trione |
|---|---|
| PubChem CID | 2784639 |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,3,4-trione |
| SMILES | O=C1C(=O)c2cccc3c2N(CCC3)C1=O |
| InChI | InChI=1S/C12H9NO3/c14-10-8-5-1-3-7-4-2-6-13(9(7)8)12(16)11(10)15/h1,3,5H,2,4,6H2 |
| InChIKey | LOGJHKARPDLIGK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|