About 4-(diethoxymethyl)-2,5-diphenyl-5H-1,3-thiazol-4-ol
4-(diethoxymethyl)-2,5-diphenyl-5H-1,3-thiazol-4-ol (PubChem CID 2784706) has the molecular formula C20H23NO3S
and a molecular weight of 357.48 g/mol. Its IUPAC name is 4-(diethoxymethyl)-2,5-diphenyl-5H-1,3-thiazol-4-ol.
Molecular Properties
| Compound Name | 4-(diethoxymethyl)-2,5-diphenyl-5H-1,3-thiazol-4-ol |
| PubChem CID | 2784706 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 4-(diethoxymethyl)-2,5-diphenyl-5H-1,3-thiazol-4-ol |
| SMILES | CCOC(OCC)C1(O)N=C(c2ccccc2)SC1c1ccccc1 |
| InChI | InChI=1S/C20H23NO3S/c1-3-23-19(24-4-2)20(22)17(15-11-7-5-8-12-15)25-18(21-20)16-13-9-6-10-14-16/h5-14,17,19,22H,3-4H2,1-2H3 |
| InChIKey | NFYCTKDQLNFOMN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-(diethoxymethyl)-2,5-diphenyl-5H-1,3-thiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethoxymethyl)-2,5-diphenyl-5H-1,3-thiazol-4-ol?
The IUPAC name of 4-(diethoxymethyl)-2,5-diphenyl-5H-1,3-thiazol-4-ol (CID 2784706) is 4-(diethoxymethyl)-2,5-diphenyl-5H-1,3-thiazol-4-ol.
What is the SMILES notation for 4-(diethoxymethyl)-2,5-diphenyl-5H-1,3-thiazol-4-ol?
The canonical SMILES for 4-(diethoxymethyl)-2,5-diphenyl-5H-1,3-thiazol-4-ol is CCOC(OCC)C1(O)N=C(c2ccccc2)SC1c1ccccc1.
What is the InChIKey of 4-(diethoxymethyl)-2,5-diphenyl-5H-1,3-thiazol-4-ol?
The InChIKey is NFYCTKDQLNFOMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO3S/c1-3-23-19(24-4-2)20(22)17(15-11-7-5-8-12-15)25-18(21-20)16-13-9-6-10-14-16/h5-14,17,19,22H,3-4H2,1-2H3.
What are the key properties of 4-(diethoxymethyl)-2,5-diphenyl-5H-1,3-thiazol-4-ol?
4-(diethoxymethyl)-2,5-diphenyl-5H-1,3-thiazol-4-ol has a molecular weight of 357.48 g/mol, XLogP of 4.01, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethoxymethyl)-2,5-diphenyl-5H-1,3-thiazol-4-ol is sourced from PubChem (CID 2784706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).