About Triphenylverdazyl
Triphenylverdazyl (PubChem CID 2784788) has the molecular formula C20H17N4
and a molecular weight of 313.38 g/mol.
Molecular Properties
| Compound Name | Triphenylverdazyl |
| PubChem CID | 2784788 |
| Molecular Formula | C20H17N4 |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | — |
| SMILES | c1ccc(C2=NN(c3ccccc3)CN(c3ccccc3)[N]2)cc1 |
| InChI | InChI=1S/C20H17N4/c1-4-10-17(11-5-1)20-21-23(18-12-6-2-7-13-18)16-24(22-20)19-14-8-3-9-15-19/h1-15H,16H2 |
| InChIKey | QWOULGJZUVANFE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 32.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Triphenylverdazyl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Triphenylverdazyl?
The IUPAC name of Triphenylverdazyl (CID 2784788) is not available.
What is the SMILES notation for Triphenylverdazyl?
The canonical SMILES for Triphenylverdazyl is c1ccc(C2=NN(c3ccccc3)CN(c3ccccc3)[N]2)cc1.
What is the InChIKey of Triphenylverdazyl?
The InChIKey is QWOULGJZUVANFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N4/c1-4-10-17(11-5-1)20-21-23(18-12-6-2-7-13-18)16-24(22-20)19-14-8-3-9-15-19/h1-15H,16H2.
What are the key properties of Triphenylverdazyl?
Triphenylverdazyl has a molecular weight of 313.38 g/mol, XLogP of 3.85, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Triphenylverdazyl is sourced from PubChem (CID 2784788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).