C17H12N2O4 — CID 2784820
2,4,6-trioxo-1,3-diphenyl-1,3-diazinane-5-carbaldehyde (PubChem CID 2784820) has the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. Its IUPAC name is 2,4,6-trioxo-1,3-diphenyl-1,3-diazinane-5-carbaldehyde.
| Compound Name | 2,4,6-trioxo-1,3-diphenyl-1,3-diazinane-5-carbaldehyde |
|---|---|
| PubChem CID | 2784820 |
| Molecular Formula | C17H12N2O4 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2,4,6-trioxo-1,3-diphenyl-1,3-diazinane-5-carbaldehyde |
| SMILES | O=CC1C(=O)N(c2ccccc2)C(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C17H12N2O4/c20-11-14-15(21)18(12-7-3-1-4-8-12)17(23)19(16(14)22)13-9-5-2-6-10-13/h1-11,14H |
| InChIKey | JWMKYRMLCUHXTP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|