C16H12N2O3 — CID 2784952
1,3-diphenyl-1,3-diazinane-2,4,6-trione (PubChem CID 2784952) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is 1,3-diphenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-diphenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2784952 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1,3-diphenyl-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1CC(=O)N(c2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C16H12N2O3/c19-14-11-15(20)18(13-9-5-2-6-10-13)16(21)17(14)12-7-3-1-4-8-12/h1-10H,11H2 |
| InChIKey | FBQJKKPQBMSWEP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|