C12H9Cl2NO2 — CID 2785059
3,3-dichloro-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,4-dione (PubChem CID 2785059) has the molecular formula C12H9Cl2NO2 and a molecular weight of 270.11 g/mol. Its IUPAC name is 3,3-dichloro-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,4-dione.
| Compound Name | 3,3-dichloro-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,4-dione |
|---|---|
| PubChem CID | 2785059 |
| Molecular Formula | C12H9Cl2NO2 |
| Molecular Weight | 270.11 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 3,3-dichloro-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,4-dione |
| SMILES | O=C1c2cccc3c2N(CCC3)C(=O)C1(Cl)Cl |
| InChI | InChI=1S/C12H9Cl2NO2/c13-12(14)10(16)8-5-1-3-7-4-2-6-15(9(7)8)11(12)17/h1,3,5H,2,4,6H2 |
| InChIKey | KLZLDDNLEVACMY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.11 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|