C17H17ClN2O3 — CID 27851286
(3aR,6aR)-3-(4-chlorophenyl)-5-cyclohexyl-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 27851286) has the molecular formula C17H17ClN2O3 and a molecular weight of 332.79 g/mol. Its IUPAC name is (3aR,6aR)-3-(4-chlorophenyl)-5-cyclohexyl-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3aR,6aR)-3-(4-chlorophenyl)-5-cyclohexyl-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 27851286 |
| Molecular Formula | C17H17ClN2O3 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | (3aR,6aR)-3-(4-chlorophenyl)-5-cyclohexyl-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | O=C1[C@@H]2C(c3ccc(Cl)cc3)=NO[C@H]2C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C17H17ClN2O3/c18-11-8-6-10(7-9-11)14-13-15(23-19-14)17(22)20(16(13)21)12-4-2-1-3-5-12/h6-9,12-13,15H,1-5H2/t13-,15-/m1/s1 |
| InChIKey | MORMXIXWWMDUIH-UKRRQHHQSA-N |
| XLogP | 2.76 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|