About 2-(diethylamino)-1,3-thiazole-5-carbaldehyde
2-(diethylamino)-1,3-thiazole-5-carbaldehyde (PubChem CID 2785412) has the molecular formula C8H12N2OS
and a molecular weight of 184.26 g/mol. Its IUPAC name is 2-(diethylamino)-1,3-thiazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-(diethylamino)-1,3-thiazole-5-carbaldehyde |
| PubChem CID | 2785412 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 2-(diethylamino)-1,3-thiazole-5-carbaldehyde |
| SMILES | CCN(CC)c1ncc(C=O)s1 |
| InChI | InChI=1S/C8H12N2OS/c1-3-10(4-2)8-9-5-7(6-11)12-8/h5-6H,3-4H2,1-2H3 |
| InChIKey | KMNXYBHVYDCCNC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)-1,3-thiazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)-1,3-thiazole-5-carbaldehyde?
The IUPAC name of 2-(diethylamino)-1,3-thiazole-5-carbaldehyde (CID 2785412) is 2-(diethylamino)-1,3-thiazole-5-carbaldehyde.
What is the SMILES notation for 2-(diethylamino)-1,3-thiazole-5-carbaldehyde?
The canonical SMILES for 2-(diethylamino)-1,3-thiazole-5-carbaldehyde is CCN(CC)c1ncc(C=O)s1.
What is the InChIKey of 2-(diethylamino)-1,3-thiazole-5-carbaldehyde?
The InChIKey is KMNXYBHVYDCCNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS/c1-3-10(4-2)8-9-5-7(6-11)12-8/h5-6H,3-4H2,1-2H3.
What are the key properties of 2-(diethylamino)-1,3-thiazole-5-carbaldehyde?
2-(diethylamino)-1,3-thiazole-5-carbaldehyde has a molecular weight of 184.26 g/mol, XLogP of 1.80, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)-1,3-thiazole-5-carbaldehyde is sourced from PubChem (CID 2785412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).