About 9-methylphenaleno[2,1-d][1,3]oxazol-7-one
9-methylphenaleno[2,1-d][1,3]oxazol-7-one (PubChem CID 2785446) has the molecular formula C15H9NO2
and a molecular weight of 235.24 g/mol. Its IUPAC name is 9-methylphenaleno[2,1-d][1,3]oxazol-7-one.
Molecular Properties
| Compound Name | 9-methylphenaleno[2,1-d][1,3]oxazol-7-one |
| PubChem CID | 2785446 |
| Molecular Formula | C15H9NO2 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 9-methylphenaleno[2,1-d][1,3]oxazol-7-one |
| SMILES | Cc1nc2c(o1)-c1cccc3cccc(c13)C2=O |
| InChI | InChI=1S/C15H9NO2/c1-8-16-13-14(17)10-6-2-4-9-5-3-7-11(12(9)10)15(13)18-8/h2-7H,1H3 |
| InChIKey | ZKHVZRSIOPOLKA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-methylphenaleno[2,1-d][1,3]oxazol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methylphenaleno[2,1-d][1,3]oxazol-7-one?
The IUPAC name of 9-methylphenaleno[2,1-d][1,3]oxazol-7-one (CID 2785446) is 9-methylphenaleno[2,1-d][1,3]oxazol-7-one.
What is the SMILES notation for 9-methylphenaleno[2,1-d][1,3]oxazol-7-one?
The canonical SMILES for 9-methylphenaleno[2,1-d][1,3]oxazol-7-one is Cc1nc2c(o1)-c1cccc3cccc(c13)C2=O.
What is the InChIKey of 9-methylphenaleno[2,1-d][1,3]oxazol-7-one?
The InChIKey is ZKHVZRSIOPOLKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9NO2/c1-8-16-13-14(17)10-6-2-4-9-5-3-7-11(12(9)10)15(13)18-8/h2-7H,1H3.
What are the key properties of 9-methylphenaleno[2,1-d][1,3]oxazol-7-one?
9-methylphenaleno[2,1-d][1,3]oxazol-7-one has a molecular weight of 235.24 g/mol, XLogP of 3.35, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methylphenaleno[2,1-d][1,3]oxazol-7-one is sourced from PubChem (CID 2785446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).