C22H15N5O6 — CID 2785468
10,12-dimethyl-4-(4-nitrophenyl)-8-phenyl-3-oxa-5,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4-triene-7,11,13-trione (PubChem CID 2785468) has the molecular formula C22H15N5O6 and a molecular weight of 445.39 g/mol. Its IUPAC name is 10,12-dimethyl-4-(4-nitrophenyl)-8-phenyl-3-oxa-5,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4-triene-7,11,13-trione.
| Compound Name | 10,12-dimethyl-4-(4-nitrophenyl)-8-phenyl-3-oxa-5,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4-triene-7,11,13-trione |
|---|---|
| PubChem CID | 2785468 |
| Molecular Formula | C22H15N5O6 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 10,12-dimethyl-4-(4-nitrophenyl)-8-phenyl-3-oxa-5,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4-triene-7,11,13-trione |
| SMILES | Cn1c(=O)c2c3oc(-c4ccc([N+](=O)[O-])cc4)nc3c(=O)n(-c3ccccc3)c2n(C)c1=O |
| InChI | InChI=1S/C22H15N5O6/c1-24-19-15(20(28)25(2)22(24)30)17-16(21(29)26(19)13-6-4-3-5-7-13)23-18(33-17)12-8-10-14(11-9-12)27(31)32/h3-11H,1-2H3 |
| InChIKey | JWYGUOCUSQDBDX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 135.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|