C23H18N4O4 — CID 2785469
10,12-dimethyl-4-(4-methylphenyl)-8-phenyl-3-oxa-5,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4-triene-7,11,13-trione (PubChem CID 2785469) has the molecular formula C23H18N4O4 and a molecular weight of 414.42 g/mol. Its IUPAC name is 10,12-dimethyl-4-(4-methylphenyl)-8-phenyl-3-oxa-5,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4-triene-7,11,13-trione.
| Compound Name | 10,12-dimethyl-4-(4-methylphenyl)-8-phenyl-3-oxa-5,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4-triene-7,11,13-trione |
|---|---|
| PubChem CID | 2785469 |
| Molecular Formula | C23H18N4O4 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 10,12-dimethyl-4-(4-methylphenyl)-8-phenyl-3-oxa-5,8,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4-triene-7,11,13-trione |
| SMILES | Cc1ccc(-c2nc3c(=O)n(-c4ccccc4)c4c(c(=O)n(C)c(=O)n4C)c3o2)cc1 |
| InChI | InChI=1S/C23H18N4O4/c1-13-9-11-14(12-10-13)19-24-17-18(31-19)16-20(25(2)23(30)26(3)21(16)28)27(22(17)29)15-7-5-4-6-8-15/h4-12H,1-3H3 |
| InChIKey | WEVWFAGPJCIGPG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 92.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |