C13H11N3O2 — CID 2785858
1,3-dimethylpyrimido[4,5-b]quinoline-2,4-dione (PubChem CID 2785858) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 1,3-dimethylpyrimido[4,5-b]quinoline-2,4-dione.
| Compound Name | 1,3-dimethylpyrimido[4,5-b]quinoline-2,4-dione |
|---|---|
| PubChem CID | 2785858 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 1,3-dimethylpyrimido[4,5-b]quinoline-2,4-dione |
| SMILES | Cn1c(=O)c2cc3ccccc3nc2n(C)c1=O |
| InChI | InChI=1S/C13H11N3O2/c1-15-11-9(12(17)16(2)13(15)18)7-8-5-3-4-6-10(8)14-11/h3-7H,1-2H3 |
| InChIKey | VTCRFEUVBWRSMI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|