C26H20N4O3 — CID 2785886
5-anilino-8-methyl-1,3-diphenylpyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 2785886) has the molecular formula C26H20N4O3 and a molecular weight of 436.47 g/mol. Its IUPAC name is 5-anilino-8-methyl-1,3-diphenylpyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 5-anilino-8-methyl-1,3-diphenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 2785886 |
| Molecular Formula | C26H20N4O3 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 5-anilino-8-methyl-1,3-diphenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | Cn1c(=O)cc(Nc2ccccc2)c2c(=O)n(-c3ccccc3)c(=O)n(-c3ccccc3)c21 |
| InChI | InChI=1S/C26H20N4O3/c1-28-22(31)17-21(27-18-11-5-2-6-12-18)23-24(28)29(19-13-7-3-8-14-19)26(33)30(25(23)32)20-15-9-4-10-16-20/h2-17,27H,1H3 |
| InChIKey | UWHPGBMOMNSDQL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |