About 6-(hydroxyamino)-1,3-dimethylpyrimidine-2,4-dione
6-(hydroxyamino)-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 2785933) has the molecular formula C6H9N3O3
and a molecular weight of 171.16 g/mol. Its IUPAC name is 6-(hydroxyamino)-1,3-dimethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-(hydroxyamino)-1,3-dimethylpyrimidine-2,4-dione |
| PubChem CID | 2785933 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 6-(hydroxyamino)-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1c(NO)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C6H9N3O3/c1-8-4(7-12)3-5(10)9(2)6(8)11/h3,7,12H,1-2H3 |
| InChIKey | IDNXXKWTYARIKB-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(hydroxyamino)-1,3-dimethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hydroxyamino)-1,3-dimethylpyrimidine-2,4-dione?
The IUPAC name of 6-(hydroxyamino)-1,3-dimethylpyrimidine-2,4-dione (CID 2785933) is 6-(hydroxyamino)-1,3-dimethylpyrimidine-2,4-dione.
What is the SMILES notation for 6-(hydroxyamino)-1,3-dimethylpyrimidine-2,4-dione?
The canonical SMILES for 6-(hydroxyamino)-1,3-dimethylpyrimidine-2,4-dione is Cn1c(NO)cc(=O)n(C)c1=O.
What is the InChIKey of 6-(hydroxyamino)-1,3-dimethylpyrimidine-2,4-dione?
The InChIKey is IDNXXKWTYARIKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O3/c1-8-4(7-12)3-5(10)9(2)6(8)11/h3,7,12H,1-2H3.
What are the key properties of 6-(hydroxyamino)-1,3-dimethylpyrimidine-2,4-dione?
6-(hydroxyamino)-1,3-dimethylpyrimidine-2,4-dione has a molecular weight of 171.16 g/mol, XLogP of -1.11, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hydroxyamino)-1,3-dimethylpyrimidine-2,4-dione is sourced from PubChem (CID 2785933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).