C29H31N5O2 — CID 2786023
1,3-diphenyl-5,7-di(piperidin-1-yl)pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 2786023) has the molecular formula C29H31N5O2 and a molecular weight of 481.60 g/mol. Its IUPAC name is 1,3-diphenyl-5,7-di(piperidin-1-yl)pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1,3-diphenyl-5,7-di(piperidin-1-yl)pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2786023 |
| Molecular Formula | C29H31N5O2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 1,3-diphenyl-5,7-di(piperidin-1-yl)pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | O=c1c2c(N3CCCCC3)cc(N3CCCCC3)nc2n(-c2ccccc2)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C29H31N5O2/c35-28-26-24(31-17-9-3-10-18-31)21-25(32-19-11-4-12-20-32)30-27(26)33(22-13-5-1-6-14-22)29(36)34(28)23-15-7-2-8-16-23/h1-2,5-8,13-16,21H,3-4,9-12,17-20H2 |
| InChIKey | PBACXVPXFFQSGA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |