About 6-(ethylamino)-1,3-diphenylpyrimidine-2,4-dione
6-(ethylamino)-1,3-diphenylpyrimidine-2,4-dione (PubChem CID 2786043) has the molecular formula C18H17N3O2
and a molecular weight of 307.35 g/mol. Its IUPAC name is 6-(ethylamino)-1,3-diphenylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-(ethylamino)-1,3-diphenylpyrimidine-2,4-dione |
| PubChem CID | 2786043 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 6-(ethylamino)-1,3-diphenylpyrimidine-2,4-dione |
| SMILES | CCNc1cc(=O)n(-c2ccccc2)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C18H17N3O2/c1-2-19-16-13-17(22)21(15-11-7-4-8-12-15)18(23)20(16)14-9-5-3-6-10-14/h3-13,19H,2H2,1H3 |
| InChIKey | ABYHCBUJQCIGCA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(ethylamino)-1,3-diphenylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(ethylamino)-1,3-diphenylpyrimidine-2,4-dione?
The IUPAC name of 6-(ethylamino)-1,3-diphenylpyrimidine-2,4-dione (CID 2786043) is 6-(ethylamino)-1,3-diphenylpyrimidine-2,4-dione.
What is the SMILES notation for 6-(ethylamino)-1,3-diphenylpyrimidine-2,4-dione?
The canonical SMILES for 6-(ethylamino)-1,3-diphenylpyrimidine-2,4-dione is CCNc1cc(=O)n(-c2ccccc2)c(=O)n1-c1ccccc1.
What is the InChIKey of 6-(ethylamino)-1,3-diphenylpyrimidine-2,4-dione?
The InChIKey is ABYHCBUJQCIGCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2/c1-2-19-16-13-17(22)21(15-11-7-4-8-12-15)18(23)20(16)14-9-5-3-6-10-14/h3-13,19H,2H2,1H3.
What are the key properties of 6-(ethylamino)-1,3-diphenylpyrimidine-2,4-dione?
6-(ethylamino)-1,3-diphenylpyrimidine-2,4-dione has a molecular weight of 307.35 g/mol, XLogP of 2.42, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(ethylamino)-1,3-diphenylpyrimidine-2,4-dione is sourced from PubChem (CID 2786043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).