C23H28N4O3S — CID 27861422
1-(2-cyanophenyl)sulfonyl-N-[[4-(dimethylamino)phenyl]methyl]-N-methylpiperidine-4-carboxamide (PubChem CID 27861422) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is 1-(2-cyanophenyl)sulfonyl-N-[[4-(dimethylamino)phenyl]methyl]-N-methylpiperidine-4-carboxamide.
| Compound Name | 1-(2-cyanophenyl)sulfonyl-N-[[4-(dimethylamino)phenyl]methyl]-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 27861422 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 1-(2-cyanophenyl)sulfonyl-N-[[4-(dimethylamino)phenyl]methyl]-N-methylpiperidine-4-carboxamide |
| SMILES | CN(Cc1ccc(N(C)C)cc1)C(=O)C1CCN(S(=O)(=O)c2ccccc2C#N)CC1 |
| InChI | InChI=1S/C23H28N4O3S/c1-25(2)21-10-8-18(9-11-21)17-26(3)23(28)19-12-14-27(15-13-19)31(29,30)22-7-5-4-6-20(22)16-24/h4-11,19H,12-15,17H2,1-3H3 |
| InChIKey | BIGPFSUMRCCMJQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|