C11H9NO2 — CID 2786143
1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-2,3-dione (PubChem CID 2786143) has the molecular formula C11H9NO2 and a molecular weight of 187.20 g/mol. Its IUPAC name is 1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-2,3-dione.
| Compound Name | 1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-2,3-dione |
|---|---|
| PubChem CID | 2786143 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-2,3-dione |
| SMILES | O=C1C(=O)N2CCCc3cccc1c32 |
| InChI | InChI=1S/C11H9NO2/c13-10-8-5-1-3-7-4-2-6-12(9(7)8)11(10)14/h1,3,5H,2,4,6H2 |
| InChIKey | KNEFHXSZIJKTPK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|