C19H23N3O4 — CID 27861722
4-amino-N-[2-(4-tert-butylphenoxy)ethyl]-3-nitrobenzamide (PubChem CID 27861722) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-amino-N-[2-(4-tert-butylphenoxy)ethyl]-3-nitrobenzamide.
| Compound Name | 4-amino-N-[2-(4-tert-butylphenoxy)ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 27861722 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-amino-N-[2-(4-tert-butylphenoxy)ethyl]-3-nitrobenzamide |
| SMILES | CC(C)(C)c1ccc(OCCNC(=O)c2ccc(N)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H23N3O4/c1-19(2,3)14-5-7-15(8-6-14)26-11-10-21-18(23)13-4-9-16(20)17(12-13)22(24)25/h4-9,12H,10-11,20H2,1-3H3,(H,21,23) |
| InChIKey | XJXDAEDDEFUPRZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|