About 2,2-dichloro-1-(5,10-dihydrophenazin-1-yl)ethanone
2,2-dichloro-1-(5,10-dihydrophenazin-1-yl)ethanone (PubChem CID 2786372) has the molecular formula C14H10Cl2N2O
and a molecular weight of 293.15 g/mol. Its IUPAC name is 2,2-dichloro-1-(5,10-dihydrophenazin-1-yl)ethanone.
Molecular Properties
| Compound Name | 2,2-dichloro-1-(5,10-dihydrophenazin-1-yl)ethanone |
| PubChem CID | 2786372 |
| Molecular Formula | C14H10Cl2N2O |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 2,2-dichloro-1-(5,10-dihydrophenazin-1-yl)ethanone |
| SMILES | O=C(c1cccc2c1Nc1ccccc1N2)C(Cl)Cl |
| InChI | InChI=1S/C14H10Cl2N2O/c15-14(16)13(19)8-4-3-7-11-12(8)18-10-6-2-1-5-9(10)17-11/h1-7,14,17-18H |
| InChIKey | LPHMDEDDADOASV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloro-1-(5,10-dihydrophenazin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloro-1-(5,10-dihydrophenazin-1-yl)ethanone?
The IUPAC name of 2,2-dichloro-1-(5,10-dihydrophenazin-1-yl)ethanone (CID 2786372) is 2,2-dichloro-1-(5,10-dihydrophenazin-1-yl)ethanone.
What is the SMILES notation for 2,2-dichloro-1-(5,10-dihydrophenazin-1-yl)ethanone?
The canonical SMILES for 2,2-dichloro-1-(5,10-dihydrophenazin-1-yl)ethanone is O=C(c1cccc2c1Nc1ccccc1N2)C(Cl)Cl.
What is the InChIKey of 2,2-dichloro-1-(5,10-dihydrophenazin-1-yl)ethanone?
The InChIKey is LPHMDEDDADOASV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2N2O/c15-14(16)13(19)8-4-3-7-11-12(8)18-10-6-2-1-5-9(10)17-11/h1-7,14,17-18H.
What are the key properties of 2,2-dichloro-1-(5,10-dihydrophenazin-1-yl)ethanone?
2,2-dichloro-1-(5,10-dihydrophenazin-1-yl)ethanone has a molecular weight of 293.15 g/mol, XLogP of 4.47, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloro-1-(5,10-dihydrophenazin-1-yl)ethanone is sourced from PubChem (CID 2786372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).