About (4bS)-4bH-pyrido[2,3-b]indol-2-amine
(4bS)-4bH-pyrido[2,3-b]indol-2-amine (PubChem CID 27866681) has the molecular formula C11H9N3
and a molecular weight of 183.21 g/mol. Its IUPAC name is (4bS)-4bH-pyrido[2,3-b]indol-2-amine.
Molecular Properties
| Compound Name | (4bS)-4bH-pyrido[2,3-b]indol-2-amine |
| PubChem CID | 27866681 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | (4bS)-4bH-pyrido[2,3-b]indol-2-amine |
| SMILES | Nc1ccc2c(n1)N=C1C=CC=C[C@H]12 |
| InChI | InChI=1S/C11H9N3/c12-10-6-5-8-7-3-1-2-4-9(7)13-11(8)14-10/h1-7H,(H2,12,14)/t7-/m0/s1 |
| InChIKey | PDOGMEOTHUKLHD-ZETCQYMHSA-N |
| XLogP | 1.96 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4bS)-4bH-pyrido[2,3-b]indol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4bS)-4bH-pyrido[2,3-b]indol-2-amine?
The IUPAC name of (4bS)-4bH-pyrido[2,3-b]indol-2-amine (CID 27866681) is (4bS)-4bH-pyrido[2,3-b]indol-2-amine.
What is the SMILES notation for (4bS)-4bH-pyrido[2,3-b]indol-2-amine?
The canonical SMILES for (4bS)-4bH-pyrido[2,3-b]indol-2-amine is Nc1ccc2c(n1)N=C1C=CC=C[C@H]12.
What is the InChIKey of (4bS)-4bH-pyrido[2,3-b]indol-2-amine?
The InChIKey is PDOGMEOTHUKLHD-ZETCQYMHSA-N. The full InChI is InChI=1S/C11H9N3/c12-10-6-5-8-7-3-1-2-4-9(7)13-11(8)14-10/h1-7H,(H2,12,14)/t7-/m0/s1.
What are the key properties of (4bS)-4bH-pyrido[2,3-b]indol-2-amine?
(4bS)-4bH-pyrido[2,3-b]indol-2-amine has a molecular weight of 183.21 g/mol, XLogP of 1.96, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4bS)-4bH-pyrido[2,3-b]indol-2-amine is sourced from PubChem (CID 27866681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).