About 4-chloro-3,5,6-trimethyl-1H-pyridin-2-one
4-chloro-3,5,6-trimethyl-1H-pyridin-2-one (PubChem CID 2786712) has the molecular formula C8H10ClNO
and a molecular weight of 171.63 g/mol. Its IUPAC name is 4-chloro-3,5,6-trimethyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-chloro-3,5,6-trimethyl-1H-pyridin-2-one |
| PubChem CID | 2786712 |
| Molecular Formula | C8H10ClNO |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 4-chloro-3,5,6-trimethyl-1H-pyridin-2-one |
| SMILES | Cc1[nH]c(=O)c(C)c(Cl)c1C |
| InChI | InChI=1S/C8H10ClNO/c1-4-6(3)10-8(11)5(2)7(4)9/h1-3H3,(H,10,11) |
| InChIKey | BTHUHLGZYGIIQJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-3,5,6-trimethyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3,5,6-trimethyl-1H-pyridin-2-one?
The IUPAC name of 4-chloro-3,5,6-trimethyl-1H-pyridin-2-one (CID 2786712) is 4-chloro-3,5,6-trimethyl-1H-pyridin-2-one.
What is the SMILES notation for 4-chloro-3,5,6-trimethyl-1H-pyridin-2-one?
The canonical SMILES for 4-chloro-3,5,6-trimethyl-1H-pyridin-2-one is Cc1[nH]c(=O)c(C)c(Cl)c1C.
What is the InChIKey of 4-chloro-3,5,6-trimethyl-1H-pyridin-2-one?
The InChIKey is BTHUHLGZYGIIQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClNO/c1-4-6(3)10-8(11)5(2)7(4)9/h1-3H3,(H,10,11).
What are the key properties of 4-chloro-3,5,6-trimethyl-1H-pyridin-2-one?
4-chloro-3,5,6-trimethyl-1H-pyridin-2-one has a molecular weight of 171.63 g/mol, XLogP of 1.95, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3,5,6-trimethyl-1H-pyridin-2-one is sourced from PubChem (CID 2786712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).