C17H13Cl3N2O5 — CID 27867956
[2-[(3,4-dichlorophenyl)methyl-methylamino]-2-oxoethyl] 2-chloro-5-nitrobenzoate (PubChem CID 27867956) has the molecular formula C17H13Cl3N2O5 and a molecular weight of 431.66 g/mol. Its IUPAC name is [2-[(3,4-dichlorophenyl)methyl-methylamino]-2-oxoethyl] 2-chloro-5-nitrobenzoate.
| Compound Name | [2-[(3,4-dichlorophenyl)methyl-methylamino]-2-oxoethyl] 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 27867956 |
| Molecular Formula | C17H13Cl3N2O5 |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 429.99 |
| IUPAC Name | [2-[(3,4-dichlorophenyl)methyl-methylamino]-2-oxoethyl] 2-chloro-5-nitrobenzoate |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)C(=O)COC(=O)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C17H13Cl3N2O5/c1-21(8-10-2-4-14(19)15(20)6-10)16(23)9-27-17(24)12-7-11(22(25)26)3-5-13(12)18/h2-7H,8-9H2,1H3 |
| InChIKey | KRIRRAMVUNEJDA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|