About 1-(3,5-dimethylphenyl)-3-(4-sulfamoylphenyl)urea
1-(3,5-dimethylphenyl)-3-(4-sulfamoylphenyl)urea (PubChem CID 27868075) has the molecular formula C15H17N3O3S
and a molecular weight of 319.39 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-(4-sulfamoylphenyl)urea.
Molecular Properties
| Compound Name | 1-(3,5-dimethylphenyl)-3-(4-sulfamoylphenyl)urea |
| PubChem CID | 27868075 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-(4-sulfamoylphenyl)urea |
| SMILES | Cc1cc(C)cc(NC(=O)Nc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C15H17N3O3S/c1-10-7-11(2)9-13(8-10)18-15(19)17-12-3-5-14(6-4-12)22(16,20)21/h3-9H,1-2H3,(H2,16,20,21)(H2,17,18,19) |
| InChIKey | SPEYBQKWONGMOH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,5-dimethylphenyl)-3-(4-sulfamoylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethylphenyl)-3-(4-sulfamoylphenyl)urea?
The IUPAC name of 1-(3,5-dimethylphenyl)-3-(4-sulfamoylphenyl)urea (CID 27868075) is 1-(3,5-dimethylphenyl)-3-(4-sulfamoylphenyl)urea.
What is the SMILES notation for 1-(3,5-dimethylphenyl)-3-(4-sulfamoylphenyl)urea?
The canonical SMILES for 1-(3,5-dimethylphenyl)-3-(4-sulfamoylphenyl)urea is Cc1cc(C)cc(NC(=O)Nc2ccc(S(N)(=O)=O)cc2)c1.
What is the InChIKey of 1-(3,5-dimethylphenyl)-3-(4-sulfamoylphenyl)urea?
The InChIKey is SPEYBQKWONGMOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O3S/c1-10-7-11(2)9-13(8-10)18-15(19)17-12-3-5-14(6-4-12)22(16,20)21/h3-9H,1-2H3,(H2,16,20,21)(H2,17,18,19).
What are the key properties of 1-(3,5-dimethylphenyl)-3-(4-sulfamoylphenyl)urea?
1-(3,5-dimethylphenyl)-3-(4-sulfamoylphenyl)urea has a molecular weight of 319.39 g/mol, XLogP of 2.59, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethylphenyl)-3-(4-sulfamoylphenyl)urea is sourced from PubChem (CID 27868075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).