About 2-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide
2-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 2787059) has the molecular formula C13H9N3O3S
and a molecular weight of 287.30 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide |
| PubChem CID | 2787059 |
| Molecular Formula | C13H9N3O3S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Nc1nccs1 |
| InChI | InChI=1S/C13H9N3O3S/c17-10(15-13-14-5-6-20-13)7-16-11(18)8-3-1-2-4-9(8)12(16)19/h1-6H,7H2,(H,14,15,17) |
| InChIKey | KKKDVCPAXUUMBE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide (CID 2787059) is 2-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide is O=C(CN1C(=O)c2ccccc2C1=O)Nc1nccs1.
What is the InChIKey of 2-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide?
The InChIKey is KKKDVCPAXUUMBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O3S/c17-10(15-13-14-5-6-20-13)7-16-11(18)8-3-1-2-4-9(8)12(16)19/h1-6H,7H2,(H,14,15,17).
What are the key properties of 2-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide?
2-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide has a molecular weight of 287.30 g/mol, XLogP of 1.38, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 2787059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).