C21H22N4O8 — CID 2787063
methyl 2,6-bis[(4-nitrobenzoyl)amino]hexanoate (PubChem CID 2787063) has the molecular formula C21H22N4O8 and a molecular weight of 458.43 g/mol. Its IUPAC name is methyl 2,6-bis[(4-nitrobenzoyl)amino]hexanoate.
| Compound Name | methyl 2,6-bis[(4-nitrobenzoyl)amino]hexanoate |
|---|---|
| PubChem CID | 2787063 |
| Molecular Formula | C21H22N4O8 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | methyl 2,6-bis[(4-nitrobenzoyl)amino]hexanoate |
| SMILES | COC(=O)C(CCCCNC(=O)c1ccc([N+](=O)[O-])cc1)NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H22N4O8/c1-33-21(28)18(23-20(27)15-7-11-17(12-8-15)25(31)32)4-2-3-13-22-19(26)14-5-9-16(10-6-14)24(29)30/h5-12,18H,2-4,13H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | WHJBDEUJUMNSJS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 170.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|